![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| October Messages.png | 2014-10-02 10:09 | 8.8K | |
| Hear the Plea.png | 2014-10-14 12:07 | 16K | |
| O Zion, Haste.png | 2014-10-14 12:07 | 16K | |
| Our End is Come.png | 2014-10-08 09:55 | 16K | |
| The Road to Revival.png | 2014-10-21 12:20 | 16K | |
| The Controlling Peac..> | 2014-10-14 12:07 | 17K | |
| Sustaining the Serva..> | 2014-10-16 12:30 | 17K | |
| The Steps of a Good ..> | 2014-10-16 12:30 | 17K | |
| Four Ingredients for..> | 2014-10-14 12:07 | 17K | |
| Are We Doing What Th..> | 2014-10-08 09:55 | 17K | |
| Ye Are Bought With a..> | 2014-10-14 12:07 | 17K | |
| Beware of the Pharis..> | 2014-10-29 10:57 | 18K | |
| Bidding Others to th..> | 2014-10-21 12:20 | 18K | |
| The Necessity of a W..> | 2014-10-29 10:57 | 18K | |
| The Structure of the..> | 2014-10-02 10:08 | 19K | |
| The Structure of the..> | 2014-10-09 08:26 | 20K | |
| The Structure of the..> | 2014-10-23 08:54 | 20K | |
| The Necessity of a W..> | 2014-12-03 15:25 | 20K | |
| The Ordinances of th..> | 2014-10-30 09:58 | 20K | |
